C10H12FN3O2 — CID 110872339
N-(5-fluoro-3-pyridinyl)morpholine-4-carboxamide (PubChem CID 110872339) has the molecular formula C10H12FN3O2 and a molecular weight of 225.22 g/mol. Its IUPAC name is N-(5-fluoro-3-pyridinyl)morpholine-4-carboxamide.
| Compound Name | N-(5-fluoro-3-pyridinyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 110872339 |
| Molecular Formula | C10H12FN3O2 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-(5-fluoro-3-pyridinyl)morpholine-4-carboxamide |
| SMILES | O=C(Nc1cncc(F)c1)N1CCOCC1 |
| InChI | InChI=1S/C10H12FN3O2/c11-8-5-9(7-12-6-8)13-10(15)14-1-3-16-4-2-14/h5-7H,1-4H2,(H,13,15) |
| InChIKey | PHOXGEGAYMPWGB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |