C14H18FN3O — CID 128625378
(3aS,7aR)-N-(5-fluoro-3-pyridinyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide (PubChem CID 128625378) has the molecular formula C14H18FN3O and a molecular weight of 263.32 g/mol. Its IUPAC name is (3aS,7aR)-N-(5-fluoro-3-pyridinyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide.
| Compound Name | (3aS,7aR)-N-(5-fluoro-3-pyridinyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 128625378 |
| Molecular Formula | C14H18FN3O |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (3aS,7aR)-N-(5-fluoro-3-pyridinyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboxamide |
| SMILES | O=C(Nc1cncc(F)c1)N1C[C@H]2CCCC[C@H]2C1 |
| InChI | InChI=1S/C14H18FN3O/c15-12-5-13(7-16-6-12)17-14(19)18-8-10-3-1-2-4-11(10)9-18/h5-7,10-11H,1-4,8-9H2,(H,17,19)/t10-,11+ |
| InChIKey | MMUSDCXGAMXEJT-PHIMTYICSA-N |
| XLogP | 2.87 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |