C10H11FN2OS — CID 129349225
(3R)-N-(5-fluoro-3-pyridinyl)thiolane-3-carboxamide (PubChem CID 129349225) has the molecular formula C10H11FN2OS and a molecular weight of 226.28 g/mol. Its IUPAC name is (3R)-N-(5-fluoro-3-pyridinyl)thiolane-3-carboxamide.
| Compound Name | (3R)-N-(5-fluoro-3-pyridinyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 129349225 |
| Molecular Formula | C10H11FN2OS |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (3R)-N-(5-fluoro-3-pyridinyl)thiolane-3-carboxamide |
| SMILES | O=C(Nc1cncc(F)c1)[C@H]1CCSC1 |
| InChI | InChI=1S/C10H11FN2OS/c11-8-3-9(5-12-4-8)13-10(14)7-1-2-15-6-7/h3-5,7H,1-2,6H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | DZZRJDWQOHHFRP-ZETCQYMHSA-N |
| XLogP | 1.91 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |