C11H11BrClNOS — CID 103824576
N-(4-bromo-3-chlorophenyl)thiolane-3-carboxamide (PubChem CID 103824576) has the molecular formula C11H11BrClNOS and a molecular weight of 320.64 g/mol. Its IUPAC name is N-(4-bromo-3-chlorophenyl)thiolane-3-carboxamide.
| Compound Name | N-(4-bromo-3-chlorophenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 103824576 |
| Molecular Formula | C11H11BrClNOS |
| Molecular Weight | 320.64 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | N-(4-bromo-3-chlorophenyl)thiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Br)c(Cl)c1)C1CCSC1 |
| InChI | InChI=1S/C11H11BrClNOS/c12-9-2-1-8(5-10(9)13)14-11(15)7-3-4-16-6-7/h1-2,5,7H,3-4,6H2,(H,14,15) |
| InChIKey | MIWXKINYUOPQOQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |