C12H11ClF3NOS — CID 110863729
N-[4-chloro-3-(trifluoromethyl)phenyl]thiolane-3-carboxamide (PubChem CID 110863729) has the molecular formula C12H11ClF3NOS and a molecular weight of 309.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]thiolane-3-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]thiolane-3-carboxamide |
|---|---|
| PubChem CID | 110863729 |
| Molecular Formula | C12H11ClF3NOS |
| Molecular Weight | 309.74 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]thiolane-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C1CCSC1 |
| InChI | InChI=1S/C12H11ClF3NOS/c13-10-2-1-8(5-9(10)12(14,15)16)17-11(18)7-3-4-19-6-7/h1-2,5,7H,3-4,6H2,(H,17,18) |
| InChIKey | GNTZIDZQRUUCAT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |