C12H14ClNO2S — CID 110859499
N-(3-chloro-4-methoxyphenyl)thiolane-3-carboxamide (PubChem CID 110859499) has the molecular formula C12H14ClNO2S and a molecular weight of 271.77 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)thiolane-3-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 110859499 |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.77 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)thiolane-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCSC2)cc1Cl |
| InChI | InChI=1S/C12H14ClNO2S/c1-16-11-3-2-9(6-10(11)13)14-12(15)8-4-5-17-7-8/h2-3,6,8H,4-5,7H2,1H3,(H,14,15) |
| InChIKey | YYDPBFIILWCTRR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |