C18H26ClNO2 — CID 18283208
4-tert-butyl-N-(3-chloro-4-methoxyphenyl)cyclohexane-1-carboxamide (PubChem CID 18283208) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-chloro-4-methoxyphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-tert-butyl-N-(3-chloro-4-methoxyphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 18283208 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 4-tert-butyl-N-(3-chloro-4-methoxyphenyl)cyclohexane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCC(C(C)(C)C)CC2)cc1Cl |
| InChI | InChI=1S/C18H26ClNO2/c1-18(2,3)13-7-5-12(6-8-13)17(21)20-14-9-10-16(22-4)15(19)11-14/h9-13H,5-8H2,1-4H3,(H,20,21) |
| InChIKey | IMLSUIMMXIWPON-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |