C18H23ClN2O3 — CID 109144964
4-N-(3-chloro-4-methoxyphenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide (PubChem CID 109144964) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methoxyphenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(3-chloro-4-methoxyphenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109144964 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-N-(3-chloro-4-methoxyphenyl)-1-N-prop-2-enylcyclohexane-1,4-dicarboxamide |
| SMILES | C=CCNC(=O)C1CCC(C(=O)Nc2ccc(OC)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H23ClN2O3/c1-3-10-20-17(22)12-4-6-13(7-5-12)18(23)21-14-8-9-16(24-2)15(19)11-14/h3,8-9,11-13H,1,4-7,10H2,2H3,(H,20,22)(H,21,23) |
| InChIKey | AIHKTYYXYGYZEE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|