C13H17ClN2O2 — CID 43087357
2-(3-chloro-4-methoxyanilino)-N-prop-2-enylpropanamide (PubChem CID 43087357) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-N-prop-2-enylpropanamide.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 43087357 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)C(C)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-4-7-15-13(17)9(2)16-10-5-6-12(18-3)11(14)8-10/h4-6,8-9,16H,1,7H2,2-3H3,(H,15,17) |
| InChIKey | VYUPOVIAHDBHII-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|