C11H9F3INO — CID 163584041
N-[4-iodo-3-(trifluoromethyl)phenyl]cyclopropanecarboxamide (PubChem CID 163584041) has the molecular formula C11H9F3INO and a molecular weight of 355.10 g/mol. Its IUPAC name is N-[4-iodo-3-(trifluoromethyl)phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-iodo-3-(trifluoromethyl)phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 163584041 |
| Molecular Formula | C11H9F3INO |
| Molecular Weight | 355.10 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | N-[4-iodo-3-(trifluoromethyl)phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccc(I)c(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C11H9F3INO/c12-11(13,14)8-5-7(3-4-9(8)15)16-10(17)6-1-2-6/h3-6H,1-2H2,(H,16,17) |
| InChIKey | GJZCTFYVRASPSU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.10 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|