C12H18N2O — CID 144888872
ethane;N-(5-methyl-3-pyridinyl)cyclopropanecarboxamide (PubChem CID 144888872) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is ethane;N-(5-methyl-3-pyridinyl)cyclopropanecarboxamide.
| Compound Name | ethane;N-(5-methyl-3-pyridinyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 144888872 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | ethane;N-(5-methyl-3-pyridinyl)cyclopropanecarboxamide |
| SMILES | CC.Cc1cncc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-7-4-9(6-11-5-7)12-10(13)8-2-3-8;1-2/h4-6,8H,2-3H2,1H3,(H,12,13);1-2H3 |
| InChIKey | LQYHKKUFNZJKPR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |