C11H12FNO — CID 79047928
N-(3-fluoro-5-methylphenyl)cyclopropanecarboxamide (PubChem CID 79047928) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is N-(3-fluoro-5-methylphenyl)cyclopropanecarboxamide.
| Compound Name | N-(3-fluoro-5-methylphenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 79047928 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(3-fluoro-5-methylphenyl)cyclopropanecarboxamide |
| SMILES | Cc1cc(F)cc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C11H12FNO/c1-7-4-9(12)6-10(5-7)13-11(14)8-2-3-8/h4-6,8H,2-3H2,1H3,(H,13,14) |
| InChIKey | PRBOZJDVTOIRMZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |