C11H12F2N2OS — CID 81313992
N-(2-amino-4,6-difluorophenyl)thiolane-3-carboxamide (PubChem CID 81313992) has the molecular formula C11H12F2N2OS and a molecular weight of 258.29 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)thiolane-3-carboxamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)thiolane-3-carboxamide |
|---|---|
| PubChem CID | 81313992 |
| Molecular Formula | C11H12F2N2OS |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)thiolane-3-carboxamide |
| SMILES | Nc1cc(F)cc(F)c1NC(=O)C1CCSC1 |
| InChI | InChI=1S/C11H12F2N2OS/c12-7-3-8(13)10(9(14)4-7)15-11(16)6-1-2-17-5-6/h3-4,6H,1-2,5,14H2,(H,15,16) |
| InChIKey | BYCWTSMQLHAOOV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|