C15H19FN2O4S — CID 119042556
N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methyloxolane-2-carboxamide (PubChem CID 119042556) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methyloxolane-2-carboxamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 119042556 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methyloxolane-2-carboxamide |
| SMILES | CC1CCOC1C(=O)Nc1ccc(F)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H19FN2O4S/c1-9-6-7-22-14(9)15(19)17-11-4-5-12(16)13(8-11)23(20,21)18-10-2-3-10/h4-5,8-10,14,18H,2-3,6-7H2,1H3,(H,17,19) |
| InChIKey | MBNSNCWJSDYMBY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |