C14H20FN3O4S2 — CID 167990213
N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methylpyrrolidine-1-sulfonamide (PubChem CID 167990213) has the molecular formula C14H20FN3O4S2 and a molecular weight of 377.46 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methylpyrrolidine-1-sulfonamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methylpyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 167990213 |
| Molecular Formula | C14H20FN3O4S2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-3-methylpyrrolidine-1-sulfonamide |
| SMILES | CC1CCN(S(=O)(=O)Nc2ccc(F)c(S(=O)(=O)NC3CC3)c2)C1 |
| InChI | InChI=1S/C14H20FN3O4S2/c1-10-6-7-18(9-10)24(21,22)17-12-4-5-13(15)14(8-12)23(19,20)16-11-2-3-11/h4-5,8,10-11,16-17H,2-3,6-7,9H2,1H3 |
| InChIKey | GKTFTTRBGKANEX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |