C20H23FN4O3S — CID 75400069
3-anilino-N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]pyrrolidine-1-carboxamide (PubChem CID 75400069) has the molecular formula C20H23FN4O3S and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-anilino-N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]pyrrolidine-1-carboxamide.
| Compound Name | 3-anilino-N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 75400069 |
| Molecular Formula | C20H23FN4O3S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-anilino-N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(S(=O)(=O)NC2CC2)c1)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H23FN4O3S/c21-18-9-8-16(12-19(18)29(27,28)24-15-6-7-15)23-20(26)25-11-10-17(13-25)22-14-4-2-1-3-5-14/h1-5,8-9,12,15,17,22,24H,6-7,10-11,13H2,(H,23,26) |
| InChIKey | MNSHVCBHKRTEOC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |