C15H20FN3O3S — CID 119797457
N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-2-pyrrolidin-2-ylacetamide (PubChem CID 119797457) has the molecular formula C15H20FN3O3S and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119797457 |
| Molecular Formula | C15H20FN3O3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)-4-fluorophenyl]-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1ccc(F)c(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C15H20FN3O3S/c16-13-6-5-12(18-15(20)9-11-2-1-7-17-11)8-14(13)23(21,22)19-10-3-4-10/h5-6,8,10-11,17,19H,1-4,7,9H2,(H,18,20) |
| InChIKey | UGLNGHRBEPDCAY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |