C16H23N3O4S2 — CID 119939619
N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119939619) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119939619 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1ccc(NC(=O)CC2CSCCN2)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C16H23N3O4S2/c1-23-14-5-4-12(8-15(14)25(21,22)19-11-2-3-11)18-16(20)9-13-10-24-7-6-17-13/h4-5,8,11,13,17,19H,2-3,6-7,9-10H2,1H3,(H,18,20) |
| InChIKey | OHVSKULXAQIXCA-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |