C17H23N3O3S — CID 119935877
N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119935877) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935877 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | N-[3-methoxy-4-(2-oxopyrrolidin-1-yl)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1cc(NC(=O)CC2CSCCN2)ccc1N1CCCC1=O |
| InChI | InChI=1S/C17H23N3O3S/c1-23-15-9-12(4-5-14(15)20-7-2-3-17(20)22)19-16(21)10-13-11-24-8-6-18-13/h4-5,9,13,18H,2-3,6-8,10-11H2,1H3,(H,19,21) |
| InChIKey | QXHUWSJJJADTAA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |