C15H22ClN3O3S — CID 119935224
N-(5-acetamido-2-methoxyphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119935224) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is N-(5-acetamido-2-methoxyphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-(5-acetamido-2-methoxyphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119935224 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(5-acetamido-2-methoxyphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C15H21N3O3S.ClH/c1-10(19)17-11-3-4-14(21-2)13(7-11)18-15(20)8-12-9-22-6-5-16-12;/h3-4,7,12,16H,5-6,8-9H2,1-2H3,(H,17,19)(H,18,20);1H |
| InChIKey | YDFRSYRLGVXBRV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |