C14H18N2O4S — CID 115411406
5-methoxy-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid (PubChem CID 115411406) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-methoxy-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid.
| Compound Name | 5-methoxy-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid |
|---|---|
| PubChem CID | 115411406 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 5-methoxy-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid |
| SMILES | COc1ccc(NC(=O)CC2CSCCN2)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-20-10-2-3-12(11(7-10)14(18)19)16-13(17)6-9-8-21-5-4-15-9/h2-3,7,9,15H,4-6,8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | DEDUYRFCCDDUAE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |