4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid

C13H14F2N2O3S — CID 66421304

IUPAC4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid
SMILESO=C(CC1CSCCN1)Nc1cc(F)c(F)cc1C(=O)O
InChIInChI=1S/C13H14F2N2O3S/c14-9-4-8(13(19)20)11(5-10(9)15)17-12(18)3-7-6-21-2-1-16-7/h4-5,7,16H,1-3,6H2,(H,17,18)(H,19,20)
InChIKeyCUBJMIBWGWSZON-UHFFFAOYSA-N
MW316.33 g/mol
LogP1.70
Rot. Bonds4

About 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid

4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid (PubChem CID 66421304) has the molecular formula C13H14F2N2O3S and a molecular weight of 316.33 g/mol. Its IUPAC name is 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid.

Molecular Properties

Compound Name4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid
PubChem CID66421304
Molecular FormulaC13H14F2N2O3S
Molecular Weight316.33 g/mol
Exact Mass316.07
IUPAC Name4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid
SMILESO=C(CC1CSCCN1)Nc1cc(F)c(F)cc1C(=O)O
InChIInChI=1S/C13H14F2N2O3S/c14-9-4-8(13(19)20)11(5-10(9)15)17-12(18)3-7-6-21-2-1-16-7/h4-5,7,16H,1-3,6H2,(H,17,18)(H,19,20)
InChIKeyCUBJMIBWGWSZON-UHFFFAOYSA-N
XLogP1.70
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500316.33
LogP ≤ 51.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid?
The IUPAC name of 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid (CID 66421304) is 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid.
What is the SMILES notation for 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid?
The canonical SMILES for 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid is O=C(CC1CSCCN1)Nc1cc(F)c(F)cc1C(=O)O.
What is the InChIKey of 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid?
The InChIKey is CUBJMIBWGWSZON-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2O3S/c14-9-4-8(13(19)20)11(5-10(9)15)17-12(18)3-7-6-21-2-1-16-7/h4-5,7,16H,1-3,6H2,(H,17,18)(H,19,20).
What are the key properties of 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid?
4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid has a molecular weight of 316.33 g/mol, XLogP of 1.70, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-[(2-thiomorpholin-3-ylacetyl)amino]benzoic acid is sourced from PubChem (CID 66421304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).