C14H20Cl2N2OS2 — CID 119938825
N-(5-chloro-2-ethylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119938825) has the molecular formula C14H20Cl2N2OS2 and a molecular weight of 367.37 g/mol. Its IUPAC name is N-(5-chloro-2-ethylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-(5-chloro-2-ethylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119938825 |
| Molecular Formula | C14H20Cl2N2OS2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | N-(5-chloro-2-ethylsulfanylphenyl)-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CCSc1ccc(Cl)cc1NC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C14H19ClN2OS2.ClH/c1-2-20-13-4-3-10(15)7-12(13)17-14(18)8-11-9-19-6-5-16-11;/h3-4,7,11,16H,2,5-6,8-9H2,1H3,(H,17,18);1H |
| InChIKey | PYCVFWSHNCKKLP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |