C14H18ClFN2OS — CID 119937616
N-[1-(3-chloro-4-fluorophenyl)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119937616) has the molecular formula C14H18ClFN2OS and a molecular weight of 316.83 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119937616 |
| Molecular Formula | C14H18ClFN2OS |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | CC(NC(=O)CC1CSCCN1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C14H18ClFN2OS/c1-9(10-2-3-13(16)12(15)6-10)18-14(19)7-11-8-20-5-4-17-11/h2-3,6,9,11,17H,4-5,7-8H2,1H3,(H,18,19) |
| InChIKey | ZTRDFZCKJHCONK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |