C15H21FN2O2S — CID 66421239
N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 66421239) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 66421239 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[1-(3-fluoro-4-methoxyphenyl)ethyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1ccc(C(C)NC(=O)CC2CSCCN2)cc1F |
| InChI | InChI=1S/C15H21FN2O2S/c1-10(11-3-4-14(20-2)13(16)7-11)18-15(19)8-12-9-21-6-5-17-12/h3-4,7,10,12,17H,5-6,8-9H2,1-2H3,(H,18,19) |
| InChIKey | UUFOJWBBFDJNJM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |