C18H22N2OS — CID 119935410
N-(1-naphthalen-2-ylethyl)-2-thiomorpholin-3-ylacetamide (PubChem CID 119935410) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-(1-naphthalen-2-ylethyl)-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-(1-naphthalen-2-ylethyl)-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119935410 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-(1-naphthalen-2-ylethyl)-2-thiomorpholin-3-ylacetamide |
| SMILES | CC(NC(=O)CC1CSCCN1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H22N2OS/c1-13(20-18(21)11-17-12-22-9-8-19-17)15-7-6-14-4-2-3-5-16(14)10-15/h2-7,10,13,17,19H,8-9,11-12H2,1H3,(H,20,21) |
| InChIKey | XDLPJCGRNRRZGB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |