C16H24ClN3O2S — CID 119936282
N-[1-(3-acetamidophenyl)ethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride (PubChem CID 119936282) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is N-[1-(3-acetamidophenyl)ethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride.
| Compound Name | N-[1-(3-acetamidophenyl)ethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119936282 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[1-(3-acetamidophenyl)ethyl]-2-thiomorpholin-3-ylacetamide;hydrochloride |
| SMILES | CC(=O)Nc1cccc(C(C)NC(=O)CC2CSCCN2)c1.Cl |
| InChI | InChI=1S/C16H23N3O2S.ClH/c1-11(13-4-3-5-14(8-13)19-12(2)20)18-16(21)9-15-10-22-7-6-17-15;/h3-5,8,11,15,17H,6-7,9-10H2,1-2H3,(H,18,21)(H,19,20);1H |
| InChIKey | SLDRYACXUXPKDL-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |