C15H21Cl2N3O2S — CID 119936426
4-chloro-N-ethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;hydrochloride (PubChem CID 119936426) has the molecular formula C15H21Cl2N3O2S and a molecular weight of 378.33 g/mol. Its IUPAC name is 4-chloro-N-ethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;hydrochloride.
| Compound Name | 4-chloro-N-ethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119936426 |
| Molecular Formula | C15H21Cl2N3O2S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-chloro-N-ethyl-2-[(2-thiomorpholin-3-ylacetyl)amino]benzamide;hydrochloride |
| SMILES | CCNC(=O)c1ccc(Cl)cc1NC(=O)CC1CSCCN1.Cl |
| InChI | InChI=1S/C15H20ClN3O2S.ClH/c1-2-17-15(21)12-4-3-10(16)7-13(12)19-14(20)8-11-9-22-6-5-18-11;/h3-4,7,11,18H,2,5-6,8-9H2,1H3,(H,17,21)(H,19,20);1H |
| InChIKey | LBFSJBLXPMBZCF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |