C15H22N2O4S — CID 119938248
2-thiomorpholin-3-yl-N-(2,3,4-trimethoxyphenyl)acetamide (PubChem CID 119938248) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-thiomorpholin-3-yl-N-(2,3,4-trimethoxyphenyl)acetamide.
| Compound Name | 2-thiomorpholin-3-yl-N-(2,3,4-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 119938248 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-thiomorpholin-3-yl-N-(2,3,4-trimethoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CC2CSCCN2)c(OC)c1OC |
| InChI | InChI=1S/C15H22N2O4S/c1-19-12-5-4-11(14(20-2)15(12)21-3)17-13(18)8-10-9-22-7-6-16-10/h4-5,10,16H,6-9H2,1-3H3,(H,17,18) |
| InChIKey | WLHNNTQHGOBMLV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |