C19H28N4O3S — CID 119941665
N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]-2-thiomorpholin-3-ylacetamide (PubChem CID 119941665) has the molecular formula C19H28N4O3S and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]-2-thiomorpholin-3-ylacetamide.
| Compound Name | N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]-2-thiomorpholin-3-ylacetamide |
|---|---|
| PubChem CID | 119941665 |
| Molecular Formula | C19H28N4O3S |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N-[2-methoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]-2-thiomorpholin-3-ylacetamide |
| SMILES | COc1ccc(C(=O)N2CCN(C)CC2)cc1NC(=O)CC1CSCCN1 |
| InChI | InChI=1S/C19H28N4O3S/c1-22-6-8-23(9-7-22)19(25)14-3-4-17(26-2)16(11-14)21-18(24)12-15-13-27-10-5-20-15/h3-4,11,15,20H,5-10,12-13H2,1-2H3,(H,21,24) |
| InChIKey | DQBHKHAXEKHOPP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |