C14H21N3O4S — CID 119331495
4-amino-N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]butanamide (PubChem CID 119331495) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 4-amino-N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]butanamide.
| Compound Name | 4-amino-N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]butanamide |
|---|---|
| PubChem CID | 119331495 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-amino-N-[3-(cyclopropylsulfamoyl)-4-methoxyphenyl]butanamide |
| SMILES | COc1ccc(NC(=O)CCCN)cc1S(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-21-12-7-6-11(16-14(18)3-2-8-15)9-13(12)22(19,20)17-10-4-5-10/h6-7,9-10,17H,2-5,8,15H2,1H3,(H,16,18) |
| InChIKey | XPSBOLXVHCANOH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |