C14H19FN2O3S — CID 114545154
N-[3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]phenyl]acetamide (PubChem CID 114545154) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 114545154 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NC2CCC(C)C2)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O3S/c1-9-3-4-12(7-9)17-21(19,20)14-6-5-11(8-13(14)15)16-10(2)18/h5-6,8-9,12,17H,3-4,7H2,1-2H3,(H,16,18) |
| InChIKey | PMOCRINJKOSACE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |