C12H15ClFNO4S2 — CID 114546471
3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]benzenesulfonyl chloride (PubChem CID 114546471) has the molecular formula C12H15ClFNO4S2 and a molecular weight of 355.84 g/mol. Its IUPAC name is 3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 114546471 |
| Molecular Formula | C12H15ClFNO4S2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | 3-fluoro-4-[(3-methylcyclopentyl)sulfamoyl]benzenesulfonyl chloride |
| SMILES | CC1CCC(NS(=O)(=O)c2ccc(S(=O)(=O)Cl)cc2F)C1 |
| InChI | InChI=1S/C12H15ClFNO4S2/c1-8-2-3-9(6-8)15-21(18,19)12-5-4-10(7-11(12)14)20(13,16)17/h4-5,7-9,15H,2-3,6H2,1H3 |
| InChIKey | GCEQIYYAQAELJX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |