C13H15ClFNO4S — CID 114543624
2-chloro-3-fluoro-5-[(3-methylcyclopentyl)sulfamoyl]benzoic acid (PubChem CID 114543624) has the molecular formula C13H15ClFNO4S and a molecular weight of 335.78 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-[(3-methylcyclopentyl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-[(3-methylcyclopentyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 114543624 |
| Molecular Formula | C13H15ClFNO4S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-chloro-3-fluoro-5-[(3-methylcyclopentyl)sulfamoyl]benzoic acid |
| SMILES | CC1CCC(NS(=O)(=O)c2cc(F)c(Cl)c(C(=O)O)c2)C1 |
| InChI | InChI=1S/C13H15ClFNO4S/c1-7-2-3-8(4-7)16-21(19,20)9-5-10(13(17)18)12(14)11(15)6-9/h5-8,16H,2-4H2,1H3,(H,17,18) |
| InChIKey | ITYSTDQOVFVPFF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |