C10H11ClFNO4S2 — CID 62397353
3-fluoro-4-[(2-methylcyclopropyl)sulfamoyl]benzenesulfonyl chloride (PubChem CID 62397353) has the molecular formula C10H11ClFNO4S2 and a molecular weight of 327.79 g/mol. Its IUPAC name is 3-fluoro-4-[(2-methylcyclopropyl)sulfamoyl]benzenesulfonyl chloride.
| Compound Name | 3-fluoro-4-[(2-methylcyclopropyl)sulfamoyl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 62397353 |
| Molecular Formula | C10H11ClFNO4S2 |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | 3-fluoro-4-[(2-methylcyclopropyl)sulfamoyl]benzenesulfonyl chloride |
| SMILES | CC1CC1NS(=O)(=O)c1ccc(S(=O)(=O)Cl)cc1F |
| InChI | InChI=1S/C10H11ClFNO4S2/c1-6-4-9(6)13-19(16,17)10-3-2-7(5-8(10)12)18(11,14)15/h2-3,5-6,9,13H,4H2,1H3 |
| InChIKey | FMZRRUMXYMVZHO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |