C11H8BrF2NO3 — CID 107615292
1-[(4-bromo-2,5-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 107615292) has the molecular formula C11H8BrF2NO3 and a molecular weight of 320.09 g/mol. Its IUPAC name is 1-[(4-bromo-2,5-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(4-bromo-2,5-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 107615292 |
| Molecular Formula | C11H8BrF2NO3 |
| Molecular Weight | 320.09 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 1-[(4-bromo-2,5-difluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(C(=O)Nc2cc(F)c(Br)cc2F)CC1 |
| InChI | InChI=1S/C11H8BrF2NO3/c12-5-3-7(14)8(4-6(5)13)15-9(16)11(1-2-11)10(17)18/h3-4H,1-2H2,(H,15,16)(H,17,18) |
| InChIKey | JAIAUODGKWNJPQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.09 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|