C12H10N2O2S — CID 60864784
N-(3-ethynylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 60864784) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 60864784 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | N-(3-ethynylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2CSC(=O)N2)c1 |
| InChI | InChI=1S/C12H10N2O2S/c1-2-8-4-3-5-9(6-8)13-11(15)10-7-17-12(16)14-10/h1,3-6,10H,7H2,(H,13,15)(H,14,16) |
| InChIKey | LPRPVCSFINKVCW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|