C16H16F3NO — CID 115583716
N-(3-ethynylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 115583716) has the molecular formula C16H16F3NO and a molecular weight of 295.30 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(3-ethynylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115583716 |
| Molecular Formula | C16H16F3NO |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(3-ethynylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)C2CCCCC2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3NO/c1-2-11-6-5-7-12(10-11)20-15(21)13-8-3-4-9-14(13)16(17,18)19/h1,5-7,10,13-14H,3-4,8-9H2,(H,20,21) |
| InChIKey | WFHWPZSPXQXSTQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|