C15H17BrF3NO — CID 115583700
N-(4-bromo-3-methylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 115583700) has the molecular formula C15H17BrF3NO and a molecular weight of 364.21 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115583700 |
| Molecular Formula | C15H17BrF3NO |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCCCC2C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C15H17BrF3NO/c1-9-8-10(6-7-13(9)16)20-14(21)11-4-2-3-5-12(11)15(17,18)19/h6-8,11-12H,2-5H2,1H3,(H,20,21) |
| InChIKey | GABIGELNCBHMFX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |