C14H15BrF3NO — CID 47244785
N-(2-bromophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 47244785) has the molecular formula C14H15BrF3NO and a molecular weight of 350.18 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(2-bromophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 47244785 |
| Molecular Formula | C14H15BrF3NO |
| Molecular Weight | 350.18 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | N-(2-bromophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H15BrF3NO/c15-11-7-3-4-8-12(11)19-13(20)9-5-1-2-6-10(9)14(16,17)18/h3-4,7-10H,1-2,5-6H2,(H,19,20) |
| InChIKey | JAIPOEVPWGRMPL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.18 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |