C14H14BrClF3NO — CID 115606431
N-(5-bromo-2-chlorophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 115606431) has the molecular formula C14H14BrClF3NO and a molecular weight of 384.62 g/mol. Its IUPAC name is N-(5-bromo-2-chlorophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-(5-bromo-2-chlorophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 115606431 |
| Molecular Formula | C14H14BrClF3NO |
| Molecular Weight | 384.62 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | N-(5-bromo-2-chlorophenyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cc(Br)ccc1Cl)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H14BrClF3NO/c15-8-5-6-11(16)12(7-8)20-13(21)9-3-1-2-4-10(9)14(17,18)19/h5-7,9-10H,1-4H2,(H,20,21) |
| InChIKey | FCHYGATXBFWYMP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |