C15H15ClF3NO3 — CID 119178941
2-chloro-4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid (PubChem CID 119178941) has the molecular formula C15H15ClF3NO3 and a molecular weight of 349.74 g/mol. Its IUPAC name is 2-chloro-4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid.
| Compound Name | 2-chloro-4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 119178941 |
| Molecular Formula | C15H15ClF3NO3 |
| Molecular Weight | 349.74 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-chloro-4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)C2CCCCC2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H15ClF3NO3/c16-12-7-8(5-6-10(12)14(22)23)20-13(21)9-3-1-2-4-11(9)15(17,18)19/h5-7,9,11H,1-4H2,(H,20,21)(H,22,23) |
| InChIKey | OVBJEQMQOLQDST-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |