C17H20F3NO3 — CID 119252241
3-[4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]propanoic acid (PubChem CID 119252241) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is 3-[4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 119252241 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[4-[[2-(trifluoromethyl)cyclohexanecarbonyl]amino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(NC(=O)C2CCCCC2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H20F3NO3/c18-17(19,20)14-4-2-1-3-13(14)16(24)21-12-8-5-11(6-9-12)7-10-15(22)23/h5-6,8-9,13-14H,1-4,7,10H2,(H,21,24)(H,22,23) |
| InChIKey | DSGKODLBCLRQGM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |