C23H26N2O4 — CID 17233524
2-[[4-(3-phenylpropanoylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 17233524) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[[4-(3-phenylpropanoylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[[4-(3-phenylpropanoylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 17233524 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2-[[4-(3-phenylpropanoylamino)phenyl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NC(=O)C2CCCCC2C(=O)O)cc1 |
| InChI | InChI=1S/C23H26N2O4/c26-21(15-10-16-6-2-1-3-7-16)24-17-11-13-18(14-12-17)25-22(27)19-8-4-5-9-20(19)23(28)29/h1-3,6-7,11-14,19-20H,4-5,8-10,15H2,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | XZDXWULFDXNORK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |