C22H26N2O2 — CID 17222847
N-[3-(3-phenylpropanoylamino)phenyl]cyclohexanecarboxamide (PubChem CID 17222847) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[3-(3-phenylpropanoylamino)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-(3-phenylpropanoylamino)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17222847 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[3-(3-phenylpropanoylamino)phenyl]cyclohexanecarboxamide |
| SMILES | O=C(CCc1ccccc1)Nc1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H26N2O2/c25-21(15-14-17-8-3-1-4-9-17)23-19-12-7-13-20(16-19)24-22(26)18-10-5-2-6-11-18/h1,3-4,7-9,12-13,16,18H,2,5-6,10-11,14-15H2,(H,23,25)(H,24,26) |
| InChIKey | HOYWHIPOXLSBJN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |