C12H17ClN4O4S2 — CID 119465982
(4R)-N-[3-(2-aminoethylsulfamoyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride (PubChem CID 119465982) has the molecular formula C12H17ClN4O4S2 and a molecular weight of 380.88 g/mol. Its IUPAC name is (4R)-N-[3-(2-aminoethylsulfamoyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride.
| Compound Name | (4R)-N-[3-(2-aminoethylsulfamoyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119465982 |
| Molecular Formula | C12H17ClN4O4S2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (4R)-N-[3-(2-aminoethylsulfamoyl)phenyl]-2-oxo-1,3-thiazolidine-4-carboxamide;hydrochloride |
| SMILES | Cl.NCCNS(=O)(=O)c1cccc(NC(=O)[C@@H]2CSC(=O)N2)c1 |
| InChI | InChI=1S/C12H16N4O4S2.ClH/c13-4-5-14-22(19,20)9-3-1-2-8(6-9)15-11(17)10-7-21-12(18)16-10;/h1-3,6,10,14H,4-5,7,13H2,(H,15,17)(H,16,18);1H/t10-;/m0./s1 |
| InChIKey | FTNJMBYEVMTUHA-PPHPATTJSA-N |
| XLogP | 0.11 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|