C18H27N3O3S — CID 119465253
N-[3-(2-aminoethylsulfamoyl)phenyl]-2-cyclohexylcyclopropane-1-carboxamide (PubChem CID 119465253) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-[3-(2-aminoethylsulfamoyl)phenyl]-2-cyclohexylcyclopropane-1-carboxamide.
| Compound Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-cyclohexylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119465253 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | N-[3-(2-aminoethylsulfamoyl)phenyl]-2-cyclohexylcyclopropane-1-carboxamide |
| SMILES | NCCNS(=O)(=O)c1cccc(NC(=O)C2CC2C2CCCCC2)c1 |
| InChI | InChI=1S/C18H27N3O3S/c19-9-10-20-25(23,24)15-8-4-7-14(11-15)21-18(22)17-12-16(17)13-5-2-1-3-6-13/h4,7-8,11,13,16-17,20H,1-3,5-6,9-10,12,19H2,(H,21,22) |
| InChIKey | VKLVHGTXNMFMML-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |