C10H13BrN4O — CID 140776709
N-(3-amino-6-bromo-2-pyridinyl)pyrrolidine-2-carboxamide (PubChem CID 140776709) has the molecular formula C10H13BrN4O and a molecular weight of 285.14 g/mol. Its IUPAC name is N-(3-amino-6-bromo-2-pyridinyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(3-amino-6-bromo-2-pyridinyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140776709 |
| Molecular Formula | C10H13BrN4O |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | N-(3-amino-6-bromo-2-pyridinyl)pyrrolidine-2-carboxamide |
| SMILES | Nc1ccc(Br)nc1NC(=O)C1CCCN1 |
| InChI | InChI=1S/C10H13BrN4O/c11-8-4-3-6(12)9(14-8)15-10(16)7-2-1-5-13-7/h3-4,7,13H,1-2,5,12H2,(H,14,15,16) |
| InChIKey | GJGYCLABGOOVSM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|