C7H11N5O — CID 45116189
N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 45116189) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45116189 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ncn[nH]1)C1CCCN1 |
| InChI | InChI=1S/C7H11N5O/c13-6(5-2-1-3-8-5)11-7-9-4-10-12-7/h4-5,8H,1-3H2,(H2,9,10,11,12,13) |
| InChIKey | YLQZPDNZKZLFGW-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |