C9H11BN4O — CID 88938252
CID 88938252 (PubChem CID 88938252) has the molecular formula C9H11BN4O and a molecular weight of 202.03 g/mol.
| Compound Name | CID 88938252 |
|---|---|
| PubChem CID | 88938252 |
| Molecular Formula | C9H11BN4O |
| Molecular Weight | 202.03 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NC(=O)[C@@H]2CCCN2)nc1 |
| InChI | InChI=1S/C9H11BN4O/c10-6-4-12-9(13-5-6)14-8(15)7-2-1-3-11-7/h4-5,7,11H,1-3H2,(H,12,13,14,15)/t7-/m0/s1 |
| InChIKey | RRFQTSNYKLXSKS-ZETCQYMHSA-N |
| XLogP | -1.04 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.03 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|